C27H41F3O3S — CID 134867757
[13-methyl-17-(6-methylheptan-2-yl)-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 134867757) has the molecular formula C27H41F3O3S and a molecular weight of 502.68 g/mol. Its IUPAC name is [13-methyl-17-(6-methylheptan-2-yl)-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [13-methyl-17-(6-methylheptan-2-yl)-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134867757 |
| Molecular Formula | C27H41F3O3S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | [13-methyl-17-(6-methylheptan-2-yl)-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C=C(OS(=O)(=O)C(F)(F)F)CCC4C3CCC12C |
| InChI | InChI=1S/C27H41F3O3S/c1-17(2)6-5-7-18(3)24-12-13-25-23-10-8-19-16-20(33-34(31,32)27(28,29)30)9-11-21(19)22(23)14-15-26(24,25)4/h8,16-18,21-25H,5-7,9-15H2,1-4H3 |
| InChIKey | ASFBLHGMMJIATA-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|