C23H22BrNO2 — CID 134868175
(Z)-1-(4-bromophenyl)-3-(3-morpholin-4-yl-1,4-dihydronaphthalen-2-yl)prop-2-en-1-one (PubChem CID 134868175) has the molecular formula C23H22BrNO2 and a molecular weight of 424.34 g/mol. Its IUPAC name is (Z)-1-(4-bromophenyl)-3-(3-morpholin-4-yl-1,4-dihydronaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (Z)-1-(4-bromophenyl)-3-(3-morpholin-4-yl-1,4-dihydronaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134868175 |
| Molecular Formula | C23H22BrNO2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (Z)-1-(4-bromophenyl)-3-(3-morpholin-4-yl-1,4-dihydronaphthalen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C\C1=C(N2CCOCC2)Cc2ccccc2C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H22BrNO2/c24-21-8-5-17(6-9-21)23(26)10-7-20-15-18-3-1-2-4-19(18)16-22(20)25-11-13-27-14-12-25/h1-10H,11-16H2/b10-7- |
| InChIKey | MBUATHAZSMFBRX-YFHOEESVSA-N |
| XLogP | 4.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|