C30H22O3 — CID 134868316
(2E)-2-(7-methoxy-2-phenylchromen-4-ylidene)-1,2-diphenylethanone (PubChem CID 134868316) has the molecular formula C30H22O3 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2E)-2-(7-methoxy-2-phenylchromen-4-ylidene)-1,2-diphenylethanone.
| Compound Name | (2E)-2-(7-methoxy-2-phenylchromen-4-ylidene)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 134868316 |
| Molecular Formula | C30H22O3 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (2E)-2-(7-methoxy-2-phenylchromen-4-ylidene)-1,2-diphenylethanone |
| SMILES | COc1ccc2c(c1)OC(c1ccccc1)=C/C2=C(\C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H22O3/c1-32-24-17-18-25-26(20-27(33-28(25)19-24)21-11-5-2-6-12-21)29(22-13-7-3-8-14-22)30(31)23-15-9-4-10-16-23/h2-20H,1H3/b29-26+ |
| InChIKey | QBUQIJOJMDCGBV-PBBVDAKRSA-N |
| XLogP | 6.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|