C32H30O2S2 — CID 134869000
1-[(1Z,3Z)-1,4-bis(benzylsulfanyl)-4-(4-methoxyphenyl)buta-1,3-dienyl]-4-methoxybenzene (PubChem CID 134869000) has the molecular formula C32H30O2S2 and a molecular weight of 510.72 g/mol. Its IUPAC name is 1-[(1Z,3Z)-1,4-bis(benzylsulfanyl)-4-(4-methoxyphenyl)buta-1,3-dienyl]-4-methoxybenzene.
| Compound Name | 1-[(1Z,3Z)-1,4-bis(benzylsulfanyl)-4-(4-methoxyphenyl)buta-1,3-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 134869000 |
| Molecular Formula | C32H30O2S2 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 1-[(1Z,3Z)-1,4-bis(benzylsulfanyl)-4-(4-methoxyphenyl)buta-1,3-dienyl]-4-methoxybenzene |
| SMILES | COc1ccc(/C(=C/C=C(\SCc2ccccc2)c2ccc(OC)cc2)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H30O2S2/c1-33-29-17-13-27(14-18-29)31(35-23-25-9-5-3-6-10-25)21-22-32(28-15-19-30(34-2)20-16-28)36-24-26-11-7-4-8-12-26/h3-22H,23-24H2,1-2H3/b31-21-,32-22- |
| InChIKey | IKQNOKNLRSWOKY-RYJWMXFHSA-N |
| XLogP | 8.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|