C22H18ClNO2 — CID 134869149
2-benzyl-3-(4-chlorophenyl)-4-hydroxy-3,4-dihydroisoquinolin-1-one (PubChem CID 134869149) has the molecular formula C22H18ClNO2 and a molecular weight of 363.84 g/mol. Its IUPAC name is 2-benzyl-3-(4-chlorophenyl)-4-hydroxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-benzyl-3-(4-chlorophenyl)-4-hydroxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 134869149 |
| Molecular Formula | C22H18ClNO2 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-benzyl-3-(4-chlorophenyl)-4-hydroxy-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccccc2C(O)C(c2ccc(Cl)cc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H18ClNO2/c23-17-12-10-16(11-13-17)20-21(25)18-8-4-5-9-19(18)22(26)24(20)14-15-6-2-1-3-7-15/h1-13,20-21,25H,14H2 |
| InChIKey | LOUAZAHPDBIFMT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |