C23H39NO7 — CID 134869377
tert-butyl (Z,3R)-4-acetyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxododec-5-enoate (PubChem CID 134869377) has the molecular formula C23H39NO7 and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl (Z,3R)-4-acetyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxododec-5-enoate.
| Compound Name | tert-butyl (Z,3R)-4-acetyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxododec-5-enoate |
|---|---|
| PubChem CID | 134869377 |
| Molecular Formula | C23H39NO7 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | tert-butyl (Z,3R)-4-acetyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxododec-5-enoate |
| SMILES | CCCCC(=O)C/C=C\C(OC(C)=O)[C@@H](CC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H39NO7/c1-9-10-12-17(26)13-11-14-19(29-16(2)25)18(15-20(27)30-22(3,4)5)24-21(28)31-23(6,7)8/h11,14,18-19H,9-10,12-13,15H2,1-8H3,(H,24,28)/b14-11-/t18-,19?/m1/s1 |
| InChIKey | JZFMPPYRHQQBAK-PHWCTDKZSA-N |
| XLogP | 4.25 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|