C9H5Cl2F3N2 — CID 134869379
(NZ,Z)-N-(1-chloro-2,2,2-trifluoroethylidene)benzenecarbohydrazonoyl chloride (PubChem CID 134869379) has the molecular formula C9H5Cl2F3N2 and a molecular weight of 269.05 g/mol. Its IUPAC name is (NZ,Z)-N-(1-chloro-2,2,2-trifluoroethylidene)benzenecarbohydrazonoyl chloride.
| Compound Name | (NZ,Z)-N-(1-chloro-2,2,2-trifluoroethylidene)benzenecarbohydrazonoyl chloride |
|---|---|
| PubChem CID | 134869379 |
| Molecular Formula | C9H5Cl2F3N2 |
| Molecular Weight | 269.05 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | (NZ,Z)-N-(1-chloro-2,2,2-trifluoroethylidene)benzenecarbohydrazonoyl chloride |
| SMILES | FC(F)(F)/C(Cl)=N/N=C(\Cl)c1ccccc1 |
| InChI | InChI=1S/C9H5Cl2F3N2/c10-7(6-4-2-1-3-5-6)15-16-8(11)9(12,13)14/h1-5H/b15-7-,16-8- |
| InChIKey | VOKWAHSJWQRQBY-DUGOVBPYSA-N |
| XLogP | 3.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.05 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|