About [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate
[(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate (PubChem CID 134869384) has the molecular formula C15H25NO5
and a molecular weight of 299.37 g/mol. Its IUPAC name is [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate.
Molecular Properties
| Compound Name | [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate |
| PubChem CID | 134869384 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate |
| SMILES | CC(=O)C/C=C\C(OC(C)=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO5/c1-10(17)8-7-9-13(20-12(3)18)11(2)16-14(19)21-15(4,5)6/h7,9,11,13H,8H2,1-6H3,(H,16,19)/b9-7-/t11-,13?/m0/s1 |
| InChIKey | OUBBDAMAUNOKIY-WSABTXTISA-N |
| XLogP | 2.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate?
The IUPAC name of [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate (CID 134869384) is [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate.
What is the SMILES notation for [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate?
The canonical SMILES for [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate is CC(=O)C/C=C\C(OC(C)=O)[C@H](C)NC(=O)OC(C)(C)C.
What is the InChIKey of [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate?
The InChIKey is OUBBDAMAUNOKIY-WSABTXTISA-N. The full InChI is InChI=1S/C15H25NO5/c1-10(17)8-7-9-13(20-12(3)18)11(2)16-14(19)21-15(4,5)6/h7,9,11,13H,8H2,1-6H3,(H,16,19)/b9-7-/t11-,13?/m0/s1.
What are the key properties of [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate?
[(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate has a molecular weight of 299.37 g/mol, XLogP of 2.37, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate is sourced from PubChem (CID 134869384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).