C16H15NO6 — CID 134869407
trimethyl 11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10,11-tricarboxylate (PubChem CID 134869407) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is trimethyl 11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10,11-tricarboxylate.
| Compound Name | trimethyl 11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10,11-tricarboxylate |
|---|---|
| PubChem CID | 134869407 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | trimethyl 11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10,11-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2c3ccccc3C1N2C(=O)OC |
| InChI | InChI=1S/C16H15NO6/c1-21-14(18)10-11(15(19)22-2)13-9-7-5-4-6-8(9)12(10)17(13)16(20)23-3/h4-7,12-13H,1-3H3 |
| InChIKey | UMQKMZRJCQTEEF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|