C15H25NO5 — CID 134869494
[(Z,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate (PubChem CID 134869494) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is [(Z,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate.
| Compound Name | [(Z,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 134869494 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | [(Z,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxooct-4-en-3-yl] acetate |
| SMILES | CC(=O)C/C=C\C(OC(C)=O)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO5/c1-10(17)8-7-9-13(20-12(3)18)11(2)16-14(19)21-15(4,5)6/h7,9,11,13H,8H2,1-6H3,(H,16,19)/b9-7-/t11-,13?/m1/s1 |
| InChIKey | OUBBDAMAUNOKIY-KPKLLWFGSA-N |
| XLogP | 2.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|