C16H11Br2ClFN — CID 134869679
(4R,5R)-4,5-dibromo-8-chloro-1-(2-fluorophenyl)-4,5-dihydro-3H-2-benzazepine (PubChem CID 134869679) has the molecular formula C16H11Br2ClFN and a molecular weight of 431.53 g/mol. Its IUPAC name is (4R,5R)-4,5-dibromo-8-chloro-1-(2-fluorophenyl)-4,5-dihydro-3H-2-benzazepine.
| Compound Name | (4R,5R)-4,5-dibromo-8-chloro-1-(2-fluorophenyl)-4,5-dihydro-3H-2-benzazepine |
|---|---|
| PubChem CID | 134869679 |
| Molecular Formula | C16H11Br2ClFN |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 428.89 |
| IUPAC Name | (4R,5R)-4,5-dibromo-8-chloro-1-(2-fluorophenyl)-4,5-dihydro-3H-2-benzazepine |
| SMILES | Fc1ccccc1C1=NC[C@@H](Br)[C@H](Br)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H11Br2ClFN/c17-13-8-21-16(11-3-1-2-4-14(11)20)12-7-9(19)5-6-10(12)15(13)18/h1-7,13,15H,8H2/t13-,15-/m1/s1 |
| InChIKey | OGMMTCNIPYALPZ-UKRRQHHQSA-N |
| XLogP | 5.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|