C23H38O2 — CID 134869769
5,6,7,8-tetratert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one (PubChem CID 134869769) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 5,6,7,8-tetratert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one.
| Compound Name | 5,6,7,8-tetratert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one |
|---|---|
| PubChem CID | 134869769 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 5,6,7,8-tetratert-butyl-1-oxaspiro[2.5]octa-5,7-dien-4-one |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C(C(C)(C)C)=C(C(C)(C)C)C2(CO2)C1=O |
| InChI | InChI=1S/C23H38O2/c1-19(2,3)14-15(20(4,5)6)17(22(10,11)12)23(13-25-23)18(24)16(14)21(7,8)9/h13H2,1-12H3 |
| InChIKey | SGNAHUBWMOPWNB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|