About propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate
propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 13486983) has the molecular formula C20H23NO4
and a molecular weight of 341.41 g/mol. Its IUPAC name is propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| PubChem CID | 13486983 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | CCOc1cccc(C(=O)c2ccc3n2CCC3C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C20H23NO4/c1-4-24-15-7-5-6-14(12-15)19(22)18-9-8-17-16(10-11-21(17)18)20(23)25-13(2)3/h5-9,12-13,16H,4,10-11H2,1-3H3 |
| InChIKey | FWQGFEXBEXSCHX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The IUPAC name of propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (CID 13486983) is propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
What is the SMILES notation for propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The canonical SMILES for propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate is CCOc1cccc(C(=O)c2ccc3n2CCC3C(=O)OC(C)C)c1.
What is the InChIKey of propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The InChIKey is FWQGFEXBEXSCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO4/c1-4-24-15-7-5-6-14(12-15)19(22)18-9-8-17-16(10-11-21(17)18)20(23)25-13(2)3/h5-9,12-13,16H,4,10-11H2,1-3H3.
What are the key properties of propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate has a molecular weight of 341.41 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-(3-ethoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate is sourced from PubChem (CID 13486983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).