About 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane
2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane (PubChem CID 134870387) has the molecular formula C15H27NOSSi
and a molecular weight of 297.54 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane.
Molecular Properties
| Compound Name | 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane |
| PubChem CID | 134870387 |
| Molecular Formula | C15H27NOSSi |
| Molecular Weight | 297.54 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane |
| SMILES | CC(C)C(C)(C)[Si](C)(C)N=S(C)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H27NOSSi/c1-13(2)15(3,4)19(6,7)16-18(5,17)14-11-9-8-10-12-14/h8-13H,1-7H3 |
| InChIKey | GAGMNSJYQAPEOM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane?
The IUPAC name of 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane (CID 134870387) is 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane.
What is the SMILES notation for 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane?
The canonical SMILES for 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is CC(C)C(C)(C)[Si](C)(C)N=S(C)(=O)c1ccccc1.
What is the InChIKey of 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane?
The InChIKey is GAGMNSJYQAPEOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NOSSi/c1-13(2)15(3,4)19(6,7)16-18(5,17)14-11-9-8-10-12-14/h8-13H,1-7H3.
What are the key properties of 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane?
2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane has a molecular weight of 297.54 g/mol, XLogP of 4.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutan-2-yl-dimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is sourced from PubChem (CID 134870387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).