C16H16F7NO2 — CID 134870477
ethyl (Z)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylamino)hex-2-enoate (PubChem CID 134870477) has the molecular formula C16H16F7NO2 and a molecular weight of 387.30 g/mol. Its IUPAC name is ethyl (Z)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylamino)hex-2-enoate.
| Compound Name | ethyl (Z)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylamino)hex-2-enoate |
|---|---|
| PubChem CID | 134870477 |
| Molecular Formula | C16H16F7NO2 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl (Z)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylamino)hex-2-enoate |
| SMILES | CCOC(=O)/C=C(\NC(C)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H16F7NO2/c1-3-26-13(25)9-12(14(17,18)15(19,20)16(21,22)23)24-10(2)11-7-5-4-6-8-11/h4-10,24H,3H2,1-2H3/b12-9- |
| InChIKey | ANTCUQULGUGVFD-XFXZXTDPSA-N |
| XLogP | 4.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|