C26H48O5Si — CID 134870489
(3R,5S,6S)-6-[(2S,3S,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-3-hydroxy-4-methyl-5-oxohexan-2-yl]-3,5-dimethyloxan-2-one (PubChem CID 134870489) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is (3R,5S,6S)-6-[(2S,3S,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-3-hydroxy-4-methyl-5-oxohexan-2-yl]-3,5-dimethyloxan-2-one.
| Compound Name | (3R,5S,6S)-6-[(2S,3S,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-3-hydroxy-4-methyl-5-oxohexan-2-yl]-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 134870489 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | (3R,5S,6S)-6-[(2S,3S,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-3-hydroxy-4-methyl-5-oxohexan-2-yl]-3,5-dimethyloxan-2-one |
| SMILES | C[C@@H]([C@H](O)[C@@H](C)C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1)[C@H]1OC(=O)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C26H48O5Si/c1-16-15-17(2)25(29)30-23(16)19(4)21(27)18(3)22(28)24(20-13-11-10-12-14-20)31-32(8,9)26(5,6)7/h16-21,23-24,27H,10-15H2,1-9H3/t16-,17+,18+,19-,21+,23-,24-/m0/s1 |
| InChIKey | PEOFVFMBTWEMFP-XHNINQBVSA-N |
| XLogP | 5.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|