C23H36O5 — CID 134870494
(4bR,8S)-10a-(2-ethoxyethoxymethyl)-4b,8-dimethylspiro[1,2,4,4a,5,6,8,10-octahydrophenanthrene-7,2'-1,3-dioxolane]-3-one (PubChem CID 134870494) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (4bR,8S)-10a-(2-ethoxyethoxymethyl)-4b,8-dimethylspiro[1,2,4,4a,5,6,8,10-octahydrophenanthrene-7,2'-1,3-dioxolane]-3-one.
| Compound Name | (4bR,8S)-10a-(2-ethoxyethoxymethyl)-4b,8-dimethylspiro[1,2,4,4a,5,6,8,10-octahydrophenanthrene-7,2'-1,3-dioxolane]-3-one |
|---|---|
| PubChem CID | 134870494 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (4bR,8S)-10a-(2-ethoxyethoxymethyl)-4b,8-dimethylspiro[1,2,4,4a,5,6,8,10-octahydrophenanthrene-7,2'-1,3-dioxolane]-3-one |
| SMILES | CCOCCOCC12CC=C3[C@H](C)C4(CC[C@]3(C)C1CC(=O)CC2)OCCO4 |
| InChI | InChI=1S/C23H36O5/c1-4-25-11-12-26-16-22-7-5-18(24)15-20(22)21(3)9-10-23(27-13-14-28-23)17(2)19(21)6-8-22/h6,17,20H,4-5,7-16H2,1-3H3/t17-,20?,21-,22?/m0/s1 |
| InChIKey | IQEHHEQQYMALGK-SWYDAUSRSA-N |
| XLogP | 3.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|