C18H33NO3 — CID 134870516
tert-butyl (4S,5S)-5-but-3-enyl-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 134870516) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is tert-butyl (4S,5S)-5-but-3-enyl-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-5-but-3-enyl-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134870516 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | tert-butyl (4S,5S)-5-but-3-enyl-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCC[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC(C)C |
| InChI | InChI=1S/C18H33NO3/c1-9-10-11-15-14(12-13(2)3)19(18(7,8)21-15)16(20)22-17(4,5)6/h9,13-15H,1,10-12H2,2-8H3/t14-,15-/m0/s1 |
| InChIKey | LAWFVRVAOOHTCH-GJZGRUSLSA-N |
| XLogP | 4.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|