C17H18F7NO2 — CID 134870580
propan-2-yl (Z)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylamino)hex-2-enoate (PubChem CID 134870580) has the molecular formula C17H18F7NO2 and a molecular weight of 401.32 g/mol. Its IUPAC name is propan-2-yl (Z)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylamino)hex-2-enoate.
| Compound Name | propan-2-yl (Z)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylamino)hex-2-enoate |
|---|---|
| PubChem CID | 134870580 |
| Molecular Formula | C17H18F7NO2 |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | propan-2-yl (Z)-4,4,5,5,6,6,6-heptafluoro-3-(1-phenylethylamino)hex-2-enoate |
| SMILES | CC(C)OC(=O)/C=C(\NC(C)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H18F7NO2/c1-10(2)27-14(26)9-13(15(18,19)16(20,21)17(22,23)24)25-11(3)12-7-5-4-6-8-12/h4-11,25H,1-3H3/b13-9- |
| InChIKey | XCWUYDOEEPADSW-LCYFTJDESA-N |
| XLogP | 5.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|