C14H19NO2 — CID 134870610
(1S,2S,5Z,9S)-5-ethylidene-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one (PubChem CID 134870610) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (1S,2S,5Z,9S)-5-ethylidene-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one.
| Compound Name | (1S,2S,5Z,9S)-5-ethylidene-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one |
|---|---|
| PubChem CID | 134870610 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (1S,2S,5Z,9S)-5-ethylidene-2,10,10-trimethyl-3-oxa-6-azatricyclo[7.1.1.02,7]undec-6-en-4-one |
| SMILES | C/C=C1\N=C2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)OC1=O |
| InChI | InChI=1S/C14H19NO2/c1-5-9-12(16)17-14(4)10-6-8(13(10,2)3)7-11(14)15-9/h5,8,10H,6-7H2,1-4H3/b9-5-/t8-,10-,14-/m0/s1 |
| InChIKey | UNCZPIJVXMWXDM-SGRLMUQBSA-N |
| XLogP | 2.71 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|