About (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine
(E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine (PubChem CID 134870614) has the molecular formula C24H25NO
and a molecular weight of 343.47 g/mol. Its IUPAC name is (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine.
Molecular Properties
| Compound Name | (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine |
| PubChem CID | 134870614 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine |
| SMILES | CC[C@@H](ON[C@@H](/C=C/c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO/c1-2-24(22-16-10-5-11-17-22)26-25-23(21-14-8-4-9-15-21)19-18-20-12-6-3-7-13-20/h3-19,23-25H,2H2,1H3/b19-18+/t23-,24+/m0/s1 |
| InChIKey | KKHRGAJUWIFQRG-JKVWFZFJSA-N |
| XLogP | 6.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine?
The IUPAC name of (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine (CID 134870614) is (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine.
What is the SMILES notation for (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine?
The canonical SMILES for (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine is CC[C@@H](ON[C@@H](/C=C/c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine?
The InChIKey is KKHRGAJUWIFQRG-JKVWFZFJSA-N. The full InChI is InChI=1S/C24H25NO/c1-2-24(22-16-10-5-11-17-22)26-25-23(21-14-8-4-9-15-21)19-18-20-12-6-3-7-13-20/h3-19,23-25H,2H2,1H3/b19-18+/t23-,24+/m0/s1.
What are the key properties of (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine?
(E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine has a molecular weight of 343.47 g/mol, XLogP of 6.11, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,1S)-1,3-diphenyl-N-[(1R)-1-phenylpropoxy]prop-2-en-1-amine is sourced from PubChem (CID 134870614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).