C24H23NO6 — CID 134870661
1-O-benzyl 9-O-ethyl (2S,5S)-4-oxo-2-phenyl-3-oxa-1-azaspiro[4.4]non-8-ene-1,9-dicarboxylate (PubChem CID 134870661) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is 1-O-benzyl 9-O-ethyl (2S,5S)-4-oxo-2-phenyl-3-oxa-1-azaspiro[4.4]non-8-ene-1,9-dicarboxylate.
| Compound Name | 1-O-benzyl 9-O-ethyl (2S,5S)-4-oxo-2-phenyl-3-oxa-1-azaspiro[4.4]non-8-ene-1,9-dicarboxylate |
|---|---|
| PubChem CID | 134870661 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-O-benzyl 9-O-ethyl (2S,5S)-4-oxo-2-phenyl-3-oxa-1-azaspiro[4.4]non-8-ene-1,9-dicarboxylate |
| SMILES | CCOC(=O)C1=CCC[C@@]12C(=O)O[C@@H](c1ccccc1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H23NO6/c1-2-29-21(26)19-14-9-15-24(19)22(27)31-20(18-12-7-4-8-13-18)25(24)23(28)30-16-17-10-5-3-6-11-17/h3-8,10-14,20H,2,9,15-16H2,1H3/t20-,24-/m0/s1 |
| InChIKey | WYLSPUQLVACJSP-RDPSFJRHSA-N |
| XLogP | 3.90 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|