C11H14Br2O5 — CID 134870709
(1S,2R,6R,8R,9S)-8-(2,2-dibromoethenyl)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 134870709) has the molecular formula C11H14Br2O5 and a molecular weight of 386.04 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-8-(2,2-dibromoethenyl)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,9S)-8-(2,2-dibromoethenyl)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 134870709 |
| Molecular Formula | C11H14Br2O5 |
| Molecular Weight | 386.04 g/mol |
| Exact Mass | 383.92 |
| IUPAC Name | (1S,2R,6R,8R,9S)-8-(2,2-dibromoethenyl)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2O[C@H](C=C(Br)Br)[C@@H]3OCO[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C11H14Br2O5/c1-11(2)17-9-8-7(14-4-15-8)5(3-6(12)13)16-10(9)18-11/h3,5,7-10H,4H2,1-2H3/t5-,7+,8+,9-,10-/m1/s1 |
| InChIKey | VXTIRKNFUZDCNE-MFQRKTBASA-N |
| XLogP | 2.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.04 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |