C26H50O4Si — CID 134870748
(2R,3R,4R)-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one (PubChem CID 134870748) has the molecular formula C26H50O4Si and a molecular weight of 454.77 g/mol. Its IUPAC name is (2R,3R,4R)-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 134870748 |
| Molecular Formula | C26H50O4Si |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | (2R,3R,4R)-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-4-hydroxy-2-(7-hydroxyheptyl)cyclopentan-1-one |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O4Si/c1-7-8-12-15-21(30-31(5,6)26(2,3)4)17-18-23-22(24(28)20-25(23)29)16-13-10-9-11-14-19-27/h17-18,21-23,25,27,29H,7-16,19-20H2,1-6H3/b18-17+/t21-,22+,23+,25+/m0/s1 |
| InChIKey | GYMNJEDNXSNFAY-GQXQPVGISA-N |
| XLogP | 6.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|