C28H36O3S — CID 134871063
[(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-phenylsulfanylcarbonyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 134871063) has the molecular formula C28H36O3S and a molecular weight of 452.66 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-phenylsulfanylcarbonyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-phenylsulfanylcarbonyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 134871063 |
| Molecular Formula | C28H36O3S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-phenylsulfanylcarbonyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(C(=O)Sc4ccccc4)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H36O3S/c1-18(29)31-20-13-15-27(2)19(17-20)9-10-22-23-11-12-25(28(23,3)16-14-24(22)27)26(30)32-21-7-5-4-6-8-21/h4-8,12,19-20,22-24H,9-11,13-17H2,1-3H3/t19-,20-,22-,23-,24-,27-,28-/m0/s1 |
| InChIKey | SPOUDGLPIQORNG-VVSACZGGSA-N |
| XLogP | 6.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|