C39H47NO7 — CID 134871168
(2R,3R,4R,5S,6E)-6-(butoxymethoxyimino)-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-ol (PubChem CID 134871168) has the molecular formula C39H47NO7 and a molecular weight of 641.80 g/mol. Its IUPAC name is (2R,3R,4R,5S,6E)-6-(butoxymethoxyimino)-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-ol.
| Compound Name | (2R,3R,4R,5S,6E)-6-(butoxymethoxyimino)-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-ol |
|---|---|
| PubChem CID | 134871168 |
| Molecular Formula | C39H47NO7 |
| Molecular Weight | 641.80 g/mol |
| Exact Mass | 641.34 |
| IUPAC Name | (2R,3R,4R,5S,6E)-6-(butoxymethoxyimino)-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-ol |
| SMILES | CCCCOCO/N=C/[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C39H47NO7/c1-2-3-24-42-31-47-40-25-37(44-27-33-18-10-5-11-19-33)39(46-29-35-22-14-7-15-23-35)38(45-28-34-20-12-6-13-21-34)36(41)30-43-26-32-16-8-4-9-17-32/h4-23,25,36-39,41H,2-3,24,26-31H2,1H3/b40-25+/t36-,37+,38-,39-/m1/s1 |
| InChIKey | CEILPJKHONAMSX-NNUXZJFHSA-N |
| XLogP | 7.10 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.80 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|