About 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea
3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea (PubChem CID 134871171) has the molecular formula C18H19ClN2O3
and a molecular weight of 346.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea |
| PubChem CID | 134871171 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea |
| SMILES | CC1(C)Cc2cccc(CN(O)C(=O)Nc3ccc(Cl)cc3)c2O1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-18(2)10-12-4-3-5-13(16(12)24-18)11-21(23)17(22)20-15-8-6-14(19)7-9-15/h3-9,23H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | FEHCWDZNAVIENG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea?
The IUPAC name of 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea (CID 134871171) is 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea.
What is the SMILES notation for 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea?
The canonical SMILES for 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea is CC1(C)Cc2cccc(CN(O)C(=O)Nc3ccc(Cl)cc3)c2O1.
What is the InChIKey of 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea?
The InChIKey is FEHCWDZNAVIENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O3/c1-18(2)10-12-4-3-5-13(16(12)24-18)11-21(23)17(22)20-15-8-6-14(19)7-9-15/h3-9,23H,10-11H2,1-2H3,(H,20,22).
What are the key properties of 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea?
3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea has a molecular weight of 346.81 g/mol, XLogP of 4.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-1-hydroxyurea is sourced from PubChem (CID 134871171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).