C24H36N2O15 — CID 134871253
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(aminomethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(aminomethyl)oxan-2-yl]oxyoxan-3-yl] acetate (PubChem CID 134871253) has the molecular formula C24H36N2O15 and a molecular weight of 592.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(aminomethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(aminomethyl)oxan-2-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(aminomethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(aminomethyl)oxan-2-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 134871253 |
| Molecular Formula | C24H36N2O15 |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(aminomethyl)-6-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(aminomethyl)oxan-2-yl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](O[C@H]2O[C@H](CN)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)O[C@H](CN)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H36N2O15/c1-9(27)33-17-15(7-25)39-23(21(37-13(5)31)19(17)35-11(3)29)41-24-22(38-14(6)32)20(36-12(4)30)18(34-10(2)28)16(8-26)40-24/h15-24H,7-8,25-26H2,1-6H3/t15-,16-,17-,18-,19+,20+,21-,22-,23-,24-/m1/s1 |
| InChIKey | MZQHNCIBPOAMBS-FXPCSOOLSA-N |
| XLogP | -2.04 |
| TPSA | 237.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|