C27H48O4Si — CID 134871412
(1S,2S,3S,5S,8S,10S,14S)-10-[tert-butyl(dimethyl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5,14-triol (PubChem CID 134871412) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is (1S,2S,3S,5S,8S,10S,14S)-10-[tert-butyl(dimethyl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5,14-triol.
| Compound Name | (1S,2S,3S,5S,8S,10S,14S)-10-[tert-butyl(dimethyl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5,14-triol |
|---|---|
| PubChem CID | 134871412 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | (1S,2S,3S,5S,8S,10S,14S)-10-[tert-butyl(dimethyl)silyl]oxy-1,8,12,15,15-pentamethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-ene-2,5,14-triol |
| SMILES | C=C1[C@@H](O)CC[C@@]2(C)C[C@H](O[Si](C)(C)C(C)(C)C)C3=C(C)C[C@H](O)[C@@](C)([C@@H](O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C27H48O4Si/c1-16-14-20(29)27(9)23(30)22-17(2)18(28)12-13-26(22,8)15-19(21(16)25(27,6)7)31-32(10,11)24(3,4)5/h18-20,22-23,28-30H,2,12-15H2,1,3-11H3/t18-,19-,20-,22-,23-,26-,27-/m0/s1 |
| InChIKey | QBMNFHMBUJDBMC-JHLOZOEGSA-N |
| XLogP | 5.59 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|