C12H9N3O — CID 134871538
7-imino-14-oxa-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),5,9,12-pentaen-5-amine (PubChem CID 134871538) has the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. Its IUPAC name is 7-imino-14-oxa-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),5,9,12-pentaen-5-amine.
| Compound Name | 7-imino-14-oxa-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),5,9,12-pentaen-5-amine |
|---|---|
| PubChem CID | 134871538 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 7-imino-14-oxa-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),5,9,12-pentaen-5-amine |
| SMILES | [H]/N=C1\N=C(N)c2cc3c(cc21)C1C=CC3O1 |
| InChI | InChI=1S/C12H9N3O/c13-11-7-3-5-6(4-8(7)12(14)15-11)10-2-1-9(5)16-10/h1-4,9-10H,(H3,13,14,15) |
| InChIKey | XURZFMZMRPDRPV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|