About 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one
2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 13487162) has the molecular formula C8H9BrN4O
and a molecular weight of 257.09 g/mol. Its IUPAC name is 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 13487162 |
| Molecular Formula | C8H9BrN4O |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC1CC(=O)Nc2nc(N)nc(Br)c21 |
| InChI | InChI=1S/C8H9BrN4O/c1-3-2-4(14)11-7-5(3)6(9)12-8(10)13-7/h3H,2H2,1H3,(H3,10,11,12,13,14) |
| InChIKey | BUODBUKRRXHQOI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (CID 13487162) is 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one is CC1CC(=O)Nc2nc(N)nc(Br)c21.
What is the InChIKey of 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is BUODBUKRRXHQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN4O/c1-3-2-4(14)11-7-5(3)6(9)12-8(10)13-7/h3H,2H2,1H3,(H3,10,11,12,13,14).
What are the key properties of 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 257.09 g/mol, XLogP of 1.27, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-bromo-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 13487162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).