C33H41NO6Si — CID 134871890
2-(2-methyloxiran-2-yl)ethyl (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 134871890) has the molecular formula C33H41NO6Si and a molecular weight of 575.78 g/mol. Its IUPAC name is 2-(2-methyloxiran-2-yl)ethyl (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | 2-(2-methyloxiran-2-yl)ethyl (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 134871890 |
| Molecular Formula | C33H41NO6Si |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 2-(2-methyloxiran-2-yl)ethyl (2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)OCCC1(C)CO1 |
| InChI | InChI=1S/C33H41NO6Si/c1-25(40-41(32(2,3)4,27-17-11-7-12-18-27)28-19-13-8-14-20-28)29(30(35)37-22-21-33(5)24-39-33)34-31(36)38-23-26-15-9-6-10-16-26/h6-20,25,29H,21-24H2,1-5H3,(H,34,36)/t25?,29-,33?/m0/s1 |
| InChIKey | JOAAHFLTEAGFLY-PAQIEUDPSA-N |
| XLogP | 4.97 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|