C15H27F7Si — CID 134871892
tritert-butyl(1,1,2,2,3,3,3-heptafluoropropyl)silane (PubChem CID 134871892) has the molecular formula C15H27F7Si and a molecular weight of 368.45 g/mol. Its IUPAC name is tritert-butyl(1,1,2,2,3,3,3-heptafluoropropyl)silane.
| Compound Name | tritert-butyl(1,1,2,2,3,3,3-heptafluoropropyl)silane |
|---|---|
| PubChem CID | 134871892 |
| Molecular Formula | C15H27F7Si |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | tritert-butyl(1,1,2,2,3,3,3-heptafluoropropyl)silane |
| SMILES | CC(C)(C)[Si](C(C)(C)C)(C(C)(C)C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H27F7Si/c1-10(2,3)23(11(4,5)6,12(7,8)9)15(21,22)13(16,17)14(18,19)20/h1-9H3 |
| InChIKey | JUPKPQXVAHEXJI-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|