C8H13IO — CID 13487203
2-(iodomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan (PubChem CID 13487203) has the molecular formula C8H13IO and a molecular weight of 252.09 g/mol. Its IUPAC name is 2-(iodomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan.
| Compound Name | 2-(iodomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan |
|---|---|
| PubChem CID | 13487203 |
| Molecular Formula | C8H13IO |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2-(iodomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan |
| SMILES | ICC1CC2CCCC2O1 |
| InChI | InChI=1S/C8H13IO/c9-5-7-4-6-2-1-3-8(6)10-7/h6-8H,1-5H2 |
| InChIKey | TUOKGPUGQNUMBW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|