About 4-methylbenzoate;triethylazanium
4-methylbenzoate;triethylazanium (PubChem CID 134872103) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-methylbenzoate;triethylazanium.
Molecular Properties
| Compound Name | 4-methylbenzoate;triethylazanium |
| PubChem CID | 134872103 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-methylbenzoate;triethylazanium |
| SMILES | CC[NH+](CC)CC.Cc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C8H8O2.C6H15N/c1-6-2-4-7(5-3-6)8(9)10;1-4-7(5-2)6-3/h2-5H,1H3,(H,9,10);4-6H2,1-3H3 |
| InChIKey | FWMBUYLQPRBBFR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylbenzoate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzoate;triethylazanium?
The IUPAC name of 4-methylbenzoate;triethylazanium (CID 134872103) is 4-methylbenzoate;triethylazanium.
What is the SMILES notation for 4-methylbenzoate;triethylazanium?
The canonical SMILES for 4-methylbenzoate;triethylazanium is CC[NH+](CC)CC.Cc1ccc(C(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzoate;triethylazanium?
The InChIKey is FWMBUYLQPRBBFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C6H15N/c1-6-2-4-7(5-3-6)8(9)10;1-4-7(5-2)6-3/h2-5H,1H3,(H,9,10);4-6H2,1-3H3.
What are the key properties of 4-methylbenzoate;triethylazanium?
4-methylbenzoate;triethylazanium has a molecular weight of 237.34 g/mol, XLogP of 0.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzoate;triethylazanium is sourced from PubChem (CID 134872103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).