About [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium
[1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium (PubChem CID 134872179) has the molecular formula C19H21CrNO
and a molecular weight of 331.38 g/mol. Its IUPAC name is [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium.
Molecular Properties
| Compound Name | [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium |
| PubChem CID | 134872179 |
| Molecular Formula | C19H21CrNO |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium |
| SMILES | CC1(C)OC[C@H](c2ccccc2)N1C(=[Cr])Cc1ccccc1 |
| InChI | InChI=1S/C19H21NO.Cr/c1-19(2)20(14-13-16-9-5-3-6-10-16)18(15-21-19)17-11-7-4-8-12-17;/h3-12,18H,13,15H2,1-2H3;/t18-;/m1./s1 |
| InChIKey | TZEOZFCMLHYTRA-GMUIIQOCSA-N |
| XLogP | 3.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium?
The IUPAC name of [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium (CID 134872179) is [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium.
What is the SMILES notation for [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium?
The canonical SMILES for [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium is CC1(C)OC[C@H](c2ccccc2)N1C(=[Cr])Cc1ccccc1.
What is the InChIKey of [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium?
The InChIKey is TZEOZFCMLHYTRA-GMUIIQOCSA-N. The full InChI is InChI=1S/C19H21NO.Cr/c1-19(2)20(14-13-16-9-5-3-6-10-16)18(15-21-19)17-11-7-4-8-12-17;/h3-12,18H,13,15H2,1-2H3;/t18-;/m1./s1.
What are the key properties of [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium?
[1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium has a molecular weight of 331.38 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylethylidene]chromium is sourced from PubChem (CID 134872179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).