C28H47NO — CID 134872239
(8S,9S,10R,13R,14S)-N,10,13-trimethyl-17-octyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine oxide (PubChem CID 134872239) has the molecular formula C28H47NO and a molecular weight of 413.69 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S)-N,10,13-trimethyl-17-octyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine oxide.
| Compound Name | (8S,9S,10R,13R,14S)-N,10,13-trimethyl-17-octyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine oxide |
|---|---|
| PubChem CID | 134872239 |
| Molecular Formula | C28H47NO |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.37 |
| IUPAC Name | (8S,9S,10R,13R,14S)-N,10,13-trimethyl-17-octyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine oxide |
| SMILES | CCCCCCCCC1CC[C@H]2[C@@H]3CCC4=C/C(=[N+](/C)[O-])CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H47NO/c1-5-6-7-8-9-10-11-21-13-15-25-24-14-12-22-20-23(29(4)30)16-18-28(22,3)26(24)17-19-27(21,25)2/h20-21,24-26H,5-19H2,1-4H3/b29-23-/t21?,24-,25-,26-,27+,28-/m0/s1 |
| InChIKey | DUZKWISLRSVCJN-CTVZRLMZSA-N |
| XLogP | 7.90 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|