C20H14F5NO5 — CID 134872254
1-O-benzyl 2-O-(2,3,4,5,6-pentafluorobenzoyl) (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 134872254) has the molecular formula C20H14F5NO5 and a molecular weight of 443.30 g/mol. Its IUPAC name is 1-O-benzyl 2-O-(2,3,4,5,6-pentafluorobenzoyl) (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-(2,3,4,5,6-pentafluorobenzoyl) (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134872254 |
| Molecular Formula | C20H14F5NO5 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 1-O-benzyl 2-O-(2,3,4,5,6-pentafluorobenzoyl) (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC(=O)C3=C(C(=C(C(=C3F)F)F)F)F |
| InChI | InChI=1S/C20H14F5NO5/c21-13-12(14(22)16(24)17(25)15(13)23)19(28)31-18(27)11-7-4-8-26(11)20(29)30-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2/t11-/m0/s1 |
| InChIKey | ZTLCICVRCBWLFO-NSHDSACASA-N |
| XLogP | 4.00 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | 660 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|