C24H25NO3 — CID 134872338
methyl 2-[benzoyl(prop-2-enyl)amino]-2-benzylhexa-3,4-dienoate (PubChem CID 134872338) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl 2-[benzoyl(prop-2-enyl)amino]-2-benzylhexa-3,4-dienoate.
| Compound Name | methyl 2-[benzoyl(prop-2-enyl)amino]-2-benzylhexa-3,4-dienoate |
|---|---|
| PubChem CID | 134872338 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | methyl 2-[benzoyl(prop-2-enyl)amino]-2-benzylhexa-3,4-dienoate |
| SMILES | C=CCN(C(=O)c1ccccc1)C(C=C=CC)(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H25NO3/c1-4-6-17-24(23(27)28-3,19-20-13-9-7-10-14-20)25(18-5-2)22(26)21-15-11-8-12-16-21/h4-5,7-17H,2,18-19H2,1,3H3 |
| InChIKey | GTNQSEURKPUWFN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|