C16H18F3NO4 — CID 134872341
methyl (3S)-3-(phenylmethoxymethyl)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 134872341) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is methyl (3S)-3-(phenylmethoxymethyl)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
| Compound Name | methyl (3S)-3-(phenylmethoxymethyl)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 134872341 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methyl (3S)-3-(phenylmethoxymethyl)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | C=C[C@H](COCc1ccccc1)C(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C16H18F3NO4/c1-3-12(10-24-9-11-7-5-4-6-8-11)13(14(21)23-2)20-15(22)16(17,18)19/h3-8,12-13H,1,9-10H2,2H3,(H,20,22)/t12-,13?/m1/s1 |
| InChIKey | PQAZUASCMPQQHP-PZORYLMUSA-N |
| XLogP | 2.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|