About cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate
cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate (PubChem CID 134872426) has the molecular formula C8H11NO5
and a molecular weight of 201.18 g/mol. Its IUPAC name is cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate |
| PubChem CID | 134872426 |
| Molecular Formula | C8H11NO5 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C(N)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C8H11NO5/c1-4(10)14-5-3-8(5,6(9)11)7(12)13-2/h5H,3H2,1-2H3,(H2,9,11)/t5-,8-/m1/s1 |
| InChIKey | XYZBZFXARGMKSO-SVGQVSJJSA-N |
| XLogP | -1.03 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate?
The IUPAC name of cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate (CID 134872426) is cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate.
What is the SMILES notation for cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate?
The canonical SMILES for cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate is COC(=O)[C@]1(C(N)=O)C[C@H]1OC(C)=O.
What is the InChIKey of cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate?
The InChIKey is XYZBZFXARGMKSO-SVGQVSJJSA-N. The full InChI is InChI=1S/C8H11NO5/c1-4(10)14-5-3-8(5,6(9)11)7(12)13-2/h5H,3H2,1-2H3,(H2,9,11)/t5-,8-/m1/s1.
What are the key properties of cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate?
cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate has a molecular weight of 201.18 g/mol, XLogP of -1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1R,2R)-2-acetyloxy-1-carbamoylcyclopropane-1-carboxylate is sourced from PubChem (CID 134872426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).