C27H33NO3 — CID 134872536
7-phenylmethoxy-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]hept-2-yn-1-one (PubChem CID 134872536) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 7-phenylmethoxy-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]hept-2-yn-1-one.
| Compound Name | 7-phenylmethoxy-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]hept-2-yn-1-one |
|---|---|
| PubChem CID | 134872536 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 7-phenylmethoxy-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]hept-2-yn-1-one |
| SMILES | O=C(C#CCCCCOCc1ccccc1)N1CCCC[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C27H33NO3/c29-27(18-9-1-2-12-20-30-21-24-13-5-3-6-14-24)28-19-11-10-17-26(28)23-31-22-25-15-7-4-8-16-25/h3-8,13-16,26H,1-2,10-12,17,19-23H2/t26-/m0/s1 |
| InChIKey | WSNOWXMUBCHKMO-SANMLTNESA-N |
| XLogP | 4.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|