C24H33NO7 — CID 134872702
2-[(3aR,4S,7R,7aR)-2-hydroxy-1-methoxycarbonyl-7-[4-[(4-methoxyphenyl)methoxy]butyl]-2,3,3a,4,7,7a-hexahydroindol-4-yl]acetic acid (PubChem CID 134872702) has the molecular formula C24H33NO7 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[(3aR,4S,7R,7aR)-2-hydroxy-1-methoxycarbonyl-7-[4-[(4-methoxyphenyl)methoxy]butyl]-2,3,3a,4,7,7a-hexahydroindol-4-yl]acetic acid.
| Compound Name | 2-[(3aR,4S,7R,7aR)-2-hydroxy-1-methoxycarbonyl-7-[4-[(4-methoxyphenyl)methoxy]butyl]-2,3,3a,4,7,7a-hexahydroindol-4-yl]acetic acid |
|---|---|
| PubChem CID | 134872702 |
| Molecular Formula | C24H33NO7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[(3aR,4S,7R,7aR)-2-hydroxy-1-methoxycarbonyl-7-[4-[(4-methoxyphenyl)methoxy]butyl]-2,3,3a,4,7,7a-hexahydroindol-4-yl]acetic acid |
| SMILES | COC(=O)N1C(O)C[C@H]2[C@H]1[C@H](CCCCOCc1ccc(OC)cc1)C=C[C@@H]2CC(=O)O |
| InChI | InChI=1S/C24H33NO7/c1-30-19-10-6-16(7-11-19)15-32-12-4-3-5-17-8-9-18(13-22(27)28)20-14-21(26)25(23(17)20)24(29)31-2/h6-11,17-18,20-21,23,26H,3-5,12-15H2,1-2H3,(H,27,28)/t17-,18-,20-,21?,23-/m1/s1 |
| InChIKey | SVKBMTKQZOKTRH-PYVWNGBISA-N |
| XLogP | 3.43 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|