C37H38F2O7 — CID 134872714
ethyl (4S,5S,6S)-3,3-difluoro-2-oxo-4,5,6,7-tetrakis(phenylmethoxy)heptanoate (PubChem CID 134872714) has the molecular formula C37H38F2O7 and a molecular weight of 632.70 g/mol. Its IUPAC name is ethyl (4S,5S,6S)-3,3-difluoro-2-oxo-4,5,6,7-tetrakis(phenylmethoxy)heptanoate.
| Compound Name | ethyl (4S,5S,6S)-3,3-difluoro-2-oxo-4,5,6,7-tetrakis(phenylmethoxy)heptanoate |
|---|---|
| PubChem CID | 134872714 |
| Molecular Formula | C37H38F2O7 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | ethyl (4S,5S,6S)-3,3-difluoro-2-oxo-4,5,6,7-tetrakis(phenylmethoxy)heptanoate |
| SMILES | CCOC(=O)C(=O)C(F)(F)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C37H38F2O7/c1-2-43-36(41)34(40)37(38,39)35(46-26-31-21-13-6-14-22-31)33(45-25-30-19-11-5-12-20-30)32(44-24-29-17-9-4-10-18-29)27-42-23-28-15-7-3-8-16-28/h3-22,32-33,35H,2,23-27H2,1H3/t32-,33-,35-/m0/s1 |
| InChIKey | JRNPYCIUMRYCKM-BVPJJHLOSA-N |
| XLogP | 6.73 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|