C50H60O7Si — CID 134872726
benzyl (4R,5S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-5,6,7,8-tetrakis(phenylmethoxy)octanoate (PubChem CID 134872726) has the molecular formula C50H60O7Si and a molecular weight of 801.11 g/mol. Its IUPAC name is benzyl (4R,5S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-5,6,7,8-tetrakis(phenylmethoxy)octanoate.
| Compound Name | benzyl (4R,5S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-5,6,7,8-tetrakis(phenylmethoxy)octanoate |
|---|---|
| PubChem CID | 134872726 |
| Molecular Formula | C50H60O7Si |
| Molecular Weight | 801.11 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | benzyl (4R,5S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-5,6,7,8-tetrakis(phenylmethoxy)octanoate |
| SMILES | C=C(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C50H60O7Si/c1-39(49(51)56-37-44-30-20-11-21-31-44)32-45(57-58(5,6)50(2,3)4)47(54-35-42-26-16-9-17-27-42)48(55-36-43-28-18-10-19-29-43)46(53-34-41-24-14-8-15-25-41)38-52-33-40-22-12-7-13-23-40/h7-31,45-48H,1,32-38H2,2-6H3/t45-,46-,47-,48-/m1/s1 |
| InChIKey | VNQOBYQWULTDNZ-MABAWHDTSA-N |
| XLogP | 11.04 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.11 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|