C33H38O5S — CID 134872744
(2E)-2-[[(6S)-4-methoxy-3-[(1S,2S)-1-methyl-2-[(E)-4-phenylsulfanylbut-2-en-2-yl]cyclohex-3-ene-1-carbonyl]-2-oxo-1-oxaspiro[4.5]deca-3,8-dien-6-yl]methylidene]butanal (PubChem CID 134872744) has the molecular formula C33H38O5S and a molecular weight of 546.73 g/mol. Its IUPAC name is (2E)-2-[[(6S)-4-methoxy-3-[(1S,2S)-1-methyl-2-[(E)-4-phenylsulfanylbut-2-en-2-yl]cyclohex-3-ene-1-carbonyl]-2-oxo-1-oxaspiro[4.5]deca-3,8-dien-6-yl]methylidene]butanal.
| Compound Name | (2E)-2-[[(6S)-4-methoxy-3-[(1S,2S)-1-methyl-2-[(E)-4-phenylsulfanylbut-2-en-2-yl]cyclohex-3-ene-1-carbonyl]-2-oxo-1-oxaspiro[4.5]deca-3,8-dien-6-yl]methylidene]butanal |
|---|---|
| PubChem CID | 134872744 |
| Molecular Formula | C33H38O5S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (2E)-2-[[(6S)-4-methoxy-3-[(1S,2S)-1-methyl-2-[(E)-4-phenylsulfanylbut-2-en-2-yl]cyclohex-3-ene-1-carbonyl]-2-oxo-1-oxaspiro[4.5]deca-3,8-dien-6-yl]methylidene]butanal |
| SMILES | CC/C(C=O)=C\[C@@H]1CC=CCC12OC(=O)C(C(=O)[C@@]1(C)CCC=C[C@H]1/C(C)=C/CSc1ccccc1)=C2OC |
| InChI | InChI=1S/C33H38O5S/c1-5-24(22-34)21-25-13-9-12-19-33(25)30(37-4)28(31(36)38-33)29(35)32(3)18-11-10-16-27(32)23(2)17-20-39-26-14-7-6-8-15-26/h6-10,12,14-17,21-22,25,27H,5,11,13,18-20H2,1-4H3/b23-17+,24-21+/t25-,27-,32-,33?/m0/s1 |
| InChIKey | KCVGNVMPNIFZSQ-IEASKBSUSA-N |
| XLogP | 6.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|