C14H21NO4 — CID 134872770
tert-butyl (3aR,6aR)-5-cyano-2,2-dimethyl-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate (PubChem CID 134872770) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is tert-butyl (3aR,6aR)-5-cyano-2,2-dimethyl-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6aR)-5-cyano-2,2-dimethyl-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate |
|---|---|
| PubChem CID | 134872770 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl (3aR,6aR)-5-cyano-2,2-dimethyl-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C#N)C[C@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C14H21NO4/c1-12(2,3)19-11(16)14(8-15)6-9-10(7-14)18-13(4,5)17-9/h9-10H,6-7H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | JGIVZSVXHXDXBT-NXEZZACHSA-N |
| XLogP | 2.15 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |