C25H28O5S — CID 134872861
[(2E,4E)-1-(benzenesulfinyl)-11-methoxy-11-oxoundeca-2,4-dien-6-yl] benzoate (PubChem CID 134872861) has the molecular formula C25H28O5S and a molecular weight of 440.56 g/mol. Its IUPAC name is [(2E,4E)-1-(benzenesulfinyl)-11-methoxy-11-oxoundeca-2,4-dien-6-yl] benzoate.
| Compound Name | [(2E,4E)-1-(benzenesulfinyl)-11-methoxy-11-oxoundeca-2,4-dien-6-yl] benzoate |
|---|---|
| PubChem CID | 134872861 |
| Molecular Formula | C25H28O5S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [(2E,4E)-1-(benzenesulfinyl)-11-methoxy-11-oxoundeca-2,4-dien-6-yl] benzoate |
| SMILES | COC(=O)CCCCC(/C=C/C=C/CS(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28O5S/c1-29-24(26)19-11-10-16-22(30-25(27)21-13-5-2-6-14-21)15-7-4-12-20-31(28)23-17-8-3-9-18-23/h2-9,12-15,17-18,22H,10-11,16,19-20H2,1H3/b12-4+,15-7+ |
| InChIKey | QYIJKHURJADRQX-CWUHIXJFSA-N |
| XLogP | 4.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|