C15H28O9 — CID 134872904
2-[(2R,3R,4S,5S)-2,3,4,5-tetrakis(methoxymethoxy)cyclopentyl]acetaldehyde (PubChem CID 134872904) has the molecular formula C15H28O9 and a molecular weight of 352.38 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S)-2,3,4,5-tetrakis(methoxymethoxy)cyclopentyl]acetaldehyde.
| Compound Name | 2-[(2R,3R,4S,5S)-2,3,4,5-tetrakis(methoxymethoxy)cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 134872904 |
| Molecular Formula | C15H28O9 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[(2R,3R,4S,5S)-2,3,4,5-tetrakis(methoxymethoxy)cyclopentyl]acetaldehyde |
| SMILES | COCO[C@@H]1[C@H](OCOC)[C@H](OCOC)C(CC=O)[C@@H]1OCOC |
| InChI | InChI=1S/C15H28O9/c1-17-7-21-12-11(5-6-16)13(22-8-18-2)15(24-10-20-4)14(12)23-9-19-3/h6,11-15H,5,7-10H2,1-4H3/t11?,12-,13+,14-,15+ |
| InChIKey | YBMPWNOZIQFDSF-LFAHVKQVSA-N |
| XLogP | 0.16 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|