C25H44O6Si — CID 134872928
ethyl 2-[(1R,2S,5S)-2-[(E,1S)-1-acetyloxyoct-2-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-3-oxocyclopentyl]acetate (PubChem CID 134872928) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,5S)-2-[(E,1S)-1-acetyloxyoct-2-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-3-oxocyclopentyl]acetate.
| Compound Name | ethyl 2-[(1R,2S,5S)-2-[(E,1S)-1-acetyloxyoct-2-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-3-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 134872928 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | ethyl 2-[(1R,2S,5S)-2-[(E,1S)-1-acetyloxyoct-2-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-3-oxocyclopentyl]acetate |
| SMILES | CCCCC/C=C/[C@H](OC(C)=O)[C@H]1C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C25H44O6Si/c1-9-11-12-13-14-15-21(30-18(3)26)24-19(16-23(28)29-10-2)22(17-20(24)27)31-32(7,8)25(4,5)6/h14-15,19,21-22,24H,9-13,16-17H2,1-8H3/b15-14+/t19-,21-,22-,24+/m0/s1 |
| InChIKey | YHAZHLCALQJDSU-GPUPUSGMSA-N |
| XLogP | 5.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|